ChemNet > CAS > 33577-16-1 Methyl methylsulfinylmethyl sulfide
33577-16-1 Methyl methylsulfinylmethyl sulfide
| Naam product |
Methyl methylsulfinylmethyl sulfide |
| Synoniemen |
Methyl (methylthio)methyl sulphoxide; MMTS; Formaldehyde dimethyl thioacetal monoxide; Methyl (methylsulphinyl)methyl sulphide; (methylsulfanyl)(methylsulfinyl)methane; (methylsulfanyl)[(R)-methylsulfinyl]methane; (methylsulfanyl)[(S)-methylsulfinyl]methane |
| MF |
C3H8OS2 |
| Molecuulgewicht |
124.225 |
| InChI |
InChI=1/C3H8OS2/c1-5-3-6(2)4/h3H2,1-2H3/t6-/m0/s1 |
| CAS-nummer |
33577-16-1 |
| EINECS |
251-577-2 |
| Moleculaire Structuur |
|
| Dichtheid |
1.223g/cm3 |
| Smeltpunt |
222-226℃ |
| Kookpunt |
257.772°C at 760 mmHg |
| Brekingsindex |
1.56 |
| Vlampunt |
121.4°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
