ChemNet > CAS > 35213-00-4 2,6-Dinitrobenzonitrile
35213-00-4 2,6-Dinitrobenzonitrile
Naam product |
2,6-Dinitrobenzonitrile |
Engelse naam |
2,6-Dinitrobenzonitrile;Dinitrobenzonitrile; Benzonitrile, 2,6-dinitro-; 2,3-dinitrobenzonitrile |
MF |
C7H3N3O4 |
Molecuulgewicht |
193.1164 |
InChI |
InChI=1/C7H3N3O4/c8-4-5-2-1-3-6(9(11)12)7(5)10(13)14/h1-3H |
CAS-nummer |
35213-00-4 |
Moleculaire Structuur |
|
Dichtheid |
1.555g/cm3 |
Kookpunt |
387.959°C at 760 mmHg |
Brekingsindex |
1.616 |
Vlampunt |
188.431°C |
Dampdruk |
0mmHg at 25°C |
Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|