ChemNet > CAS > 3678-70-4 Diphenyl-2-pyridylmethane
3678-70-4 Diphenyl-2-pyridylmethane
Naam product |
Diphenyl-2-pyridylmethane |
Engelse naam |
Diphenyl-2-pyridylmethane; 2-Diphenylmethylpyridine; 2-benzhydrylpyridine |
MF |
C18H15N |
Molecuulgewicht |
245.3184 |
InChI |
InChI=1/C18H15N/c1-3-9-15(10-4-1)18(16-11-5-2-6-12-16)17-13-7-8-14-19-17/h1-14,18H |
CAS-nummer |
3678-70-4 |
EINECS |
222-953-3 |
Moleculaire Structuur |
|
Dichtheid |
1.085g/cm3 |
Smeltpunt |
58-61℃ |
Kookpunt |
359.8°C at 760 mmHg |
Brekingsindex |
1.607 |
Vlampunt |
153.6°C |
Dampdruk |
4.81E-05mmHg at 25°C |
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|