ChemNet > CAS > 401-56-9 ethylchlorofluoroacetate
401-56-9 ethylchlorofluoroacetate
Naam product |
ethylchlorofluoroacetate |
Synoniemen |
Ethyl chlorofluoroacetate; Chlorofluoroacetic acid ethyl ester; ethyl (2S)-chloro(fluoro)ethanoate; ethyl (2R)-chloro(fluoro)ethanoate |
MF |
C4H6ClFO2 |
Molecuulgewicht |
140.5406 |
InChI |
InChI=1/C4H6ClFO2/c1-2-8-4(7)3(5)6/h3H,2H2,1H3/t3-/m0/s1 |
CAS-nummer |
401-56-9 |
EINECS |
206-930-5 |
Moleculaire Structuur |
|
Dichtheid |
1.219g/cm3 |
Kookpunt |
129°C at 760 mmHg |
Brekingsindex |
1.39 |
Vlampunt |
44.3°C |
Gevaarsymbolen |
C:Corrosive;
|
Risico-codes |
R34:Causes burns.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|