ChemNet > CAS > 4160-51-4 4'-methoxybutyrophenone
4160-51-4 4'-methoxybutyrophenone
Naam product |
4'-methoxybutyrophenone |
Synoniemen |
1-(4-Methoxyphenyl)butan-1-on; 1-(4-Methoxyphenyl)butan-1-one; 1-Butanone, 1- (4-methoxyphenyl)-; 1-butanone, 1-(4-methoxyphenyl)-; 4'-Methoxy-butyrophenone; 4-Methoxybutyrophenone; Butyrophenone, 4'-methoxy-; p-Methoxybutyrophenone; 4-Butyrylanisole |
MF |
C11H14O2 |
Molecuulgewicht |
178.2277 |
InChI |
InChI=1/C11H14O2/c1-3-4-11(12)9-5-7-10(13-2)8-6-9/h5-8H,3-4H2,1-2H3 |
CAS-nummer |
4160-51-4 |
EINECS |
223-995-5 |
Moleculaire Structuur |
|
Dichtheid |
1.001g/cm3 |
Kookpunt |
288.3°C at 760 mmHg |
Brekingsindex |
1.498 |
Vlampunt |
124.3°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|