ChemNet > CAS > 4184-79-6 5,6-Dimethyl-1H-benzotriazole hydrate
4184-79-6 5,6-Dimethyl-1H-benzotriazole hydrate
Naam product |
5,6-Dimethyl-1H-benzotriazole hydrate |
Synoniemen |
5,6-Dimethylbenzotriazole monohydrate; 5,6-dimethyl-2H-benzotriazole |
MF |
C8H9N3 |
Molecuulgewicht |
147.1772 |
InChI |
InChI=1/C8H9N3/c1-5-3-7-8(4-6(5)2)10-11-9-7/h3-4H,1-2H3,(H,9,10,11) |
CAS-nummer |
4184-79-6 |
EINECS |
224-058-3 |
Moleculaire Structuur |
|
Dichtheid |
1.217g/cm3 |
Smeltpunt |
153-156℃ |
Kookpunt |
309.7°C at 760 mmHg |
Brekingsindex |
1.655 |
Vlampunt |
145.6°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|