4197-24-4 Carbol Fuchsin
| Naam product |
Carbol Fuchsin |
| Engelse naam |
Carbol Fuchsin; |
| MF |
C21H22ClN3 |
| Molecuulgewicht |
351.8725 |
| InChI |
InChI=1/C21H21N3.ClH/c1-13-11-16(5-9-19(13)23)21(15-3-7-18(22)8-4-15)17-6-10-20(24)14(2)12-17;/h3-12,23H,22,24H2,1-2H3;1H/b21-16-,23-19?; |
| CAS-nummer |
4197-24-4 |
| EINECS |
224-086-6 |
| Moleculaire Structuur |
|
| Kookpunt |
573.5°C at 760 mmHg |
| Vlampunt |
300.6°C |
| Dampdruk |
3.69E-13mmHg at 25°C |
| Gevaarsymbolen |
T:Toxic;
|
| Risico-codes |
R24/25:Toxic in contact with skin and if swallowed.;
R34:Causes burns.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28A:After contact with skin, wash immediately with plenty of water.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|