ChemNet > CAS > 51628-12-7 4-Iodophenylacetonitrile
51628-12-7 4-Iodophenylacetonitrile
Naam product |
4-Iodophenylacetonitrile |
Synoniemen |
4-Iodobenzyl cyanide |
MF |
C8H6IN |
Molecuulgewicht |
243.0444 |
InChI |
InChI=1/C8H6IN/c9-8-3-1-7(2-4-8)5-6-10/h1-4H,5H2 |
CAS-nummer |
51628-12-7 |
Moleculaire Structuur |
|
Dichtheid |
1.764g/cm3 |
Kookpunt |
285.8°C at 760 mmHg |
Brekingsindex |
1.624 |
Vlampunt |
126.6°C |
Gevaarsymbolen |
|
Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|