ChemNet > CAS > 571-61-9 1,5-Dimethylnaphthalene
571-61-9 1,5-Dimethylnaphthalene
Naam product |
1,5-Dimethylnaphthalene |
Synoniemen |
NSC 59388; Naphthalene, 1,5-dimethyl-; Naphthalene, 1,5-dimethyl- (8CI)(9CI); N-methyl-N-nitrosomethanamine |
MF |
C12H12 |
Molecuulgewicht |
156.2237 |
InChI |
InChI=1/C12H12/c1-9-5-3-8-12-10(2)6-4-7-11(9)12/h3-8H,1-2H3 |
CAS-nummer |
571-61-9 |
EINECS |
209-338-5 |
Moleculaire Structuur |
|
Dichtheid |
1g/cm3 |
Smeltpunt |
78-266℃ |
Kookpunt |
265.6°C at 760 mmHg |
Brekingsindex |
1.604 |
Vlampunt |
111.4°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|