ChemNet > CAS > 57238-76-3 5-(Chloromethyl)-3-(4-methoxyphenyl)- 1,2,4-oxadiazole
57238-76-3 5-(Chloromethyl)-3-(4-methoxyphenyl)- 1,2,4-oxadiazole
Naam product |
5-(Chloromethyl)-3-(4-methoxyphenyl)- 1,2,4-oxadiazole |
Synoniemen |
5-(chloromethyl)-3-(4-methoxyphenyl)-1,2,4-oxadiazole |
MF |
C10H9ClN2O2 |
Molecuulgewicht |
224.6437 |
InChI |
InChI=1/C10H9ClN2O2/c1-14-8-4-2-7(3-5-8)10-12-9(6-11)15-13-10/h2-5H,6H2,1H3 |
CAS-nummer |
57238-76-3 |
Moleculaire Structuur |
|
Dichtheid |
1.278g/cm3 |
Smeltpunt |
51℃ |
Kookpunt |
354.9°C at 760 mmHg |
Brekingsindex |
1.547 |
Vlampunt |
168.4°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|