ChemNet > CAS > 637-39-8 Triethanolamine hydrochloride
637-39-8 Triethanolamine hydrochloride
Naam product |
Triethanolamine hydrochloride |
Synoniemen |
2,2,2-Nitrilotriethanol hydrochloride~Tris(2-hydroxyethyl)amine hydrochloride; triethanolamine hcl; tris(2-hydroxyethyl)ammonium chloride; 2,2',2''-nitrilotriethanol hydrochloride (1:1) |
MF |
C6H16ClNO3 |
Molecuulgewicht |
185.6491 |
InChI |
InChI=1/C6H15NO3.ClH/c8-4-1-7(2-5-9)3-6-10;/h8-10H,1-6H2;1H |
CAS-nummer |
637-39-8 |
EINECS |
211-284-2 |
Moleculaire Structuur |
|
Smeltpunt |
177-179℃ |
Kookpunt |
335.4°C at 760 mmHg |
Vlampunt |
185°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|