ChemNet > CAS > 6972-71-0 4,5-Dimethyl-2-nitroaniline
6972-71-0 4,5-Dimethyl-2-nitroaniline
| Naam product |
4,5-Dimethyl-2-nitroaniline |
| Synoniemen |
2-Nitro-4,5-Dimethyl Aniline; 6-Nitro-3,4-xylidine |
| MF |
C8H10N2O2 |
| Molecuulgewicht |
166.1772 |
| InChI |
InChI=1/C8H10N2O2/c1-5-3-7(9)8(10(11)12)4-6(5)2/h3-4H,9H2,1-2H3 |
| CAS-nummer |
6972-71-0 |
| EINECS |
230-211-5 |
| Moleculaire Structuur |
|
| Dichtheid |
1.22g/cm3 |
| Smeltpunt |
138-143℃ |
| Kookpunt |
335.7°C at 760 mmHg |
| Brekingsindex |
1.601 |
| Vlampunt |
156.8°C |
| Gevaarsymbolen |
 Xi:Irritant;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
