ChemNet > CAS > 7149-69-1 1,3-dichloro-2-methyl-5-nitrobenzene
7149-69-1 1,3-dichloro-2-methyl-5-nitrobenzene
Naam product |
1,3-dichloro-2-methyl-5-nitrobenzene |
Synoniemen |
2,6-Dichloro-4-nitrotoluene |
MF |
C7H5Cl2NO2 |
Molecuulgewicht |
206.0261 |
InChI |
InChI=1/C7H5Cl2NO2/c1-4-6(8)2-5(10(11)12)3-7(4)9/h2-3H,1H3 |
CAS-nummer |
7149-69-1 |
Moleculaire Structuur |
|
Dichtheid |
1.456g/cm3 |
Smeltpunt |
62℃ |
Kookpunt |
279.6°C at 760 mmHg |
Brekingsindex |
1.585 |
Vlampunt |
122.9°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|