ChemNet > CAS > 71916-91-1 5-Chloro-2-fluorobenzyl bromide
71916-91-1 5-Chloro-2-fluorobenzyl bromide
Naam product |
5-Chloro-2-fluorobenzyl bromide |
Synoniemen |
alpha-Bromo-3-chloro-6-fluorotoluene; 2-Fluoro-5-chlorobenzyl bromide; 2-(bromomethyl)-4-chloro-1-fluorobenzene |
MF |
C7H5BrClF |
Molecuulgewicht |
223.47 |
InChI |
InChI=1/C7H5BrClF/c8-4-5-3-6(9)1-2-7(5)10/h1-3H,4H2 |
CAS-nummer |
71916-91-1 |
Moleculaire Structuur |
|
Dichtheid |
1.654g/cm3 |
Kookpunt |
226.7°C at 760 mmHg |
Brekingsindex |
1.561 |
Vlampunt |
90.9°C |
Gevaarsymbolen |
|
Risico-codes |
R34:Causes burns.;
R36:Irritating to eyes.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|