ChemNet > CAS > 86508-29-4 1-(4-chloorfenyl)-2-(4-methylfenyl)ethaan-1,2-dion
86508-29-4 1-(4-chloorfenyl)-2-(4-methylfenyl)ethaan-1,2-dion
Naam product |
1-(4-chloorfenyl)-2-(4-methylfenyl)ethaan-1,2-dion |
Engelse naam |
1-(4-chlorophenyl)-2-(4-methylphenyl)ethane-1,2-dione; |
MF |
C15H11ClO2 |
Molecuulgewicht |
258.6996 |
InChI |
InChI=1/C15H11ClO2/c1-10-2-4-11(5-3-10)14(17)15(18)12-6-8-13(16)9-7-12/h2-9H,1H3 |
CAS-nummer |
86508-29-4 |
Moleculaire Structuur |
|
Dichtheid |
1.24g/cm3 |
Smeltpunt |
108℃ |
Kookpunt |
413.2°C at 760 mmHg |
Brekingsindex |
1.595 |
Vlampunt |
174.5°C |
Dampdruk |
4.9E-07mmHg at 25°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|