ChemNet > CAS > 87-05-8 7-Ethoxy-4-methylcoumarin
87-05-8 7-Ethoxy-4-methylcoumarin
| Naam product |
7-Ethoxy-4-methylcoumarin |
| Synoniemen |
7-Ethoxy-4-methyl-2H-chromen-2-one; Ethyl 4-methylumbelliferyl ether |
| MF |
C12H12O3 |
| Molecuulgewicht |
204.2219 |
| InChI |
InChI=1/C12H12O3/c1-3-14-9-4-5-10-8(2)6-12(13)15-11(10)7-9/h4-7H,3H2,1-2H3 |
| CAS-nummer |
87-05-8 |
| EINECS |
201-721-5 |
| Moleculaire Structuur |
|
| Dichtheid |
1.163g/cm3 |
| Smeltpunt |
113-114℃ |
| Kookpunt |
351.4°C at 760 mmHg |
| Brekingsindex |
1.548 |
| Vlampunt |
146.2°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
