ChemNet > CAS > 886-38-4 Diphenylcyclopropenone
886-38-4 Diphenylcyclopropenone
Naam product |
Diphenylcyclopropenone |
Synoniemen |
Diphencyprone; 2,3-diphenylcycloprop-2-en-1-one; 1,2-Diphenylcycelopropen-3-One |
MF |
C15H10O |
Molecuulgewicht |
206.2393 |
InChI |
InChI=1/C15H10O/c16-15-13(11-7-3-1-4-8-11)14(15)12-9-5-2-6-10-12/h1-10H |
CAS-nummer |
886-38-4 |
EINECS |
212-948-4 |
Moleculaire Structuur |
|
Dichtheid |
1.232g/cm3 |
Smeltpunt |
119-121℃ |
Kookpunt |
407.2°C at 760 mmHg |
Brekingsindex |
1.668 |
Vlampunt |
182.7°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R43:May cause sensitization by skin contact.;
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|