ChemNet > CAS > 89-35-0 3,5-Dihydroxy-2-naphthalenecarboxylic acid
89-35-0 3,5-Dihydroxy-2-naphthalenecarboxylic acid
Naam product |
3,5-Dihydroxy-2-naphthalenecarboxylic acid |
Engelse naam |
3,5-Dihydroxy-2-naphthalenecarboxylic acid; 3,5-Dihydroxy-2-naphthoic acid; 3,5-dihydroxynaphthalene-2-carboxylic acid; 3,5-dihydroxynaphthalene-2-carboxylate |
MF |
C11H7O4 |
Molecuulgewicht |
203.1714 |
InChI |
InChI=1/C11H8O4/c12-9-3-1-2-6-4-8(11(14)15)10(13)5-7(6)9/h1-5,12-13H,(H,14,15)/p-1 |
CAS-nummer |
89-35-0 |
EINECS |
201-900-8 |
Moleculaire Structuur |
|
Smeltpunt |
275-280℃ |
Kookpunt |
442.2°C at 760 mmHg |
Vlampunt |
235.3°C |
Dampdruk |
1.35E-08mmHg at 25°C |
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|