ChemNet > CAS > 938-95-4 DL-2-(4-chlorophenyl)propan-oic acid
938-95-4 DL-2-(4-chlorophenyl)propan-oic acid
| Naam product |
DL-2-(4-chlorophenyl)propan-oic acid |
| Engelse naam |
DL-2-(4-chlorophenyl)propan-oic acid; 4-chloromethyl phenylacetic acid; 2-(4-chlorophenyl)propanoic acid; [4-(chloromethyl)phenyl]acetic acid; 2-(4-chlorophenyl)propionic acid |
| MF |
C9H9ClO2 |
| Molecuulgewicht |
184.6196 |
| InChI |
InChI=1/C9H9ClO2/c10-6-8-3-1-7(2-4-8)5-9(11)12/h1-4H,5-6H2,(H,11,12) |
| CAS-nummer |
938-95-4 |
| EINECS |
213-351-1 |
| Moleculaire Structuur |
|
| Dichtheid |
1.277g/cm3 |
| Kookpunt |
332.2°C at 760 mmHg |
| Brekingsindex |
1.565 |
| Vlampunt |
154.7°C |
| Dampdruk |
5.91E-05mmHg at 25°C |
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|