ChemNet > CAS > 98555-71-6 5-(2,5-Dichlorophenyl)-1H-tetrazole
98555-71-6 5-(2,5-Dichlorophenyl)-1H-tetrazole
Naam product |
5-(2,5-Dichlorophenyl)-1H-tetrazole |
Synoniemen |
5-(2,5-dichlorophenyl)-2H-tetrazole |
MF |
C7H4Cl2N4 |
Molecuulgewicht |
215.0395 |
InChI |
InChI=1/C7H4Cl2N4/c8-4-1-2-6(9)5(3-4)7-10-12-13-11-7/h1-3H,(H,10,11,12,13) |
CAS-nummer |
98555-71-6 |
Moleculaire Structuur |
|
Dichtheid |
1.574g/cm3 |
Kookpunt |
401.9°C at 760 mmHg |
Brekingsindex |
1.641 |
Vlampunt |
229.1°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|