ChemNet > CAS > 117695-55-3 3,5-Dibromobenzeneboronic acid
117695-55-3 3,5-Dibromobenzeneboronic acid
produktnavn |
3,5-Dibromobenzeneboronic acid |
Synonymer |
3,5-Dibromophenylboronic acid; 3,5-dibrombenzolboronsaeure; 3,5-Dibromophenyl boronic acid |
Molekylær Formel |
C6H5BBr2O2 |
Molekylvekt |
279.7217 |
InChI |
InChI=1/C6H5BBr2O2/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3,10-11H |
CAS-nummer |
117695-55-3 |
Molecular Structure |
|
Tetthet |
2.09g/cm3 |
Smeltepunkt |
300℃ |
Kokepunkt |
382.8°C at 760 mmHg |
Brytningsindeks |
1.651 |
Flammepunktet |
185.3°C |
Hazard symboler |
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|