ChemNet > CAS > 121219-12-3 4-n-Pentylbenzeneboronic acid
121219-12-3 4-n-Pentylbenzeneboronic acid
produktnavn |
4-n-Pentylbenzeneboronic acid |
Synonymer |
4-n-Amylbenzeneboronic acid; 4-n-Pentylphenylboronic acid; (4-pentylphenyl)boronic acid; 4-Pentylbenzeneboronic acid |
Molekylær Formel |
C11H17BO2 |
Molekylvekt |
192.0625 |
InChI |
InChI=1/C11H17BO2/c1-2-3-4-5-10-6-8-11(9-7-10)12(13)14/h6-9,13-14H,2-5H2,1H3 |
CAS-nummer |
121219-12-3 |
Molecular Structure |
|
Tetthet |
1.01g/cm3 |
Kokepunkt |
328°C at 760 mmHg |
Brytningsindeks |
1.509 |
Flammepunktet |
152.2°C |
Hazard symboler |
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|