ChemNet > CAS > 132741-29-8 Difluoromandelicacid
132741-29-8 Difluoromandelicacid
| produktnavn |
Difluoromandelicacid |
| Synonymer |
3,4-Difluoromandelic acid; (3,4-difluorophenyl)(hydroxy)acetic acid |
| Molekylær Formel |
C8H6F2O3 |
| Molekylvekt |
188.1282 |
| InChI |
InChI=1/C8H6F2O3/c9-5-2-1-4(3-6(5)10)7(11)8(12)13/h1-3,7,11H,(H,12,13) |
| CAS-nummer |
132741-29-8 |
| Molecular Structure |
|
| Tetthet |
1.522g/cm3 |
| Smeltepunkt |
92-94℃ |
| Kokepunkt |
320.7°C at 760 mmHg |
| Brytningsindeks |
1.542 |
| Flammepunktet |
147.8°C |
| Hazard symboler |
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
