ChemNet > CAS > 133-49-3 Penta-Chloro Thiophenol
133-49-3 Penta-Chloro Thiophenol
produktnavn |
Penta-Chloro Thiophenol |
Synonymer |
Pentachlorobenzenethiol; Pentachlorothiophenol; 2,3,4,5,6-Pentachlorobenzenethiol; Benzenethiol,pentachloro- (6CI,7CI,8CI,9CI); Benzenethiol,2,3,4,5,6-pentachloro- |
Molekylær Formel |
C6HCl5S |
Molekylvekt |
282.4021 |
InChI |
InChI=1/C6HCl5S/c7-1-2(8)4(10)6(12)5(11)3(1)9/h12H |
CAS-nummer |
133-49-3 |
EINECS |
205-107-8 |
Molecular Structure |
|
Tetthet |
1.745g/cm3 |
Smeltepunkt |
223-227℃ |
Kokepunkt |
351.3°C at 760 mmHg |
Brytningsindeks |
1.648 |
Flammepunktet |
144.6°C |
Hazard symboler |
|
Risiko Koder |
R20/22:Harmful by inhalation and if swallowed.;
|
Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|