ChemNet > CAS > 14331-56-7 4-hydrazino-2,6-dimethylpyrimidine
14331-56-7 4-hydrazino-2,6-dimethylpyrimidine
produktnavn |
4-hydrazino-2,6-dimethylpyrimidine |
Synonymer |
4-hydrazinyl-2,6-dimethylpyrimidine; (1S)-1-phenylpropan-1-ol |
Molekylær Formel |
C9H12O |
Molekylvekt |
136.191 |
InChI |
InChI=1/C9H12O/c1-2-9(10)8-6-4-3-5-7-8/h3-7,9-10H,2H2,1H3/t9-/m0/s1 |
CAS-nummer |
14331-56-7 |
EINECS |
202-256-0 |
Molecular Structure |
|
Tetthet |
0.994g/cm3 |
Smeltepunkt |
182℃ |
Kokepunkt |
219°C at 760 mmHg |
Brytningsindeks |
1.524 |
Flammepunktet |
97.3°C |
Hazard symboler |
Xn:Harmful;
|
Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Sikkerhet Beskrivelse |
S36/37:Wear suitable protective clothing and gloves.;
|
|