ChemNet > CAS > 17138-28-2 Ethyl 4-hydroxyphenylacetate
17138-28-2 Ethyl 4-hydroxyphenylacetate
produktnavn |
Ethyl 4-hydroxyphenylacetate |
Synonymer |
4-Hydroxyphenylacetic acid ethyl ester |
Molekylær Formel |
C10H12O3 |
Molekylvekt |
180.2005 |
InChI |
InChI=1/C10H12O3/c1-2-13-10(12)7-8-3-5-9(11)6-4-8/h3-6,11H,2,7H2,1H3 |
CAS-nummer |
17138-28-2 |
EINECS |
241-197-5 |
Molecular Structure |
|
Tetthet |
1.146g/cm3 |
Kokepunkt |
290.8°C at 760 mmHg |
Brytningsindeks |
1.532 |
Flammepunktet |
122.7°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|