1731-79-9 dimethyl dodecanedioate
produktnavn |
dimethyl dodecanedioate |
Engelsk navn |
dimethyl dodecanedioate; Dimethyl 1,10-decanedicarboxylate; 1,10-Decanedicarboxylic acid dimethyl ester~Dodecanedioic acid dimethyl ester; Dodecanedioic acid dimethyl ester; N-(2-Chloroethyl) Pyrrolinie HCl |
Molekylær Formel |
C14H26O4 |
Molekylvekt |
258.3538 |
InChI |
InChI=1/C14H26O4/c1-17-13(15)11-9-7-5-3-4-6-8-10-12-14(16)18-2/h3-12H2,1-2H3 |
CAS-nummer |
1731-79-9 |
EINECS |
217-050-6 |
Molecular Structure |
|
Tetthet |
0.969g/cm3 |
Kokepunkt |
300.9°C at 760 mmHg |
Brytningsindeks |
1.441 |
Flammepunktet |
135°C |
Damptrykk |
0.00109mmHg at 25°C |
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|