ChemNet > CAS > 216393-64-5 4-Bromo-2-fluorobenzeneboronic acid
216393-64-5 4-Bromo-2-fluorobenzeneboronic acid
| produktnavn |
4-Bromo-2-fluorobenzeneboronic acid |
| Synonymer |
4-Bromo-2-fluorophenylboronic acid |
| Molekylær Formel |
C6H5BBrFO2 |
| Molekylvekt |
218.8161 |
| InChI |
InChI=1/C6H5BBrFO2/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3,10-11H |
| CAS-nummer |
216393-64-5 |
| Molecular Structure |
|
| Tetthet |
1.75g/cm3 |
| Kokepunkt |
310.6°C at 760 mmHg |
| Brytningsindeks |
1.571 |
| Flammepunktet |
141.6°C |
| Hazard symboler |
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
