ChemNet > CAS > 24623-20-9 6-methyl-1-indanone
24623-20-9 6-methyl-1-indanone
produktnavn |
6-methyl-1-indanone |
Synonymer |
6-methyl-2,3-dihydro-1H-inden-1-one |
Molekylær Formel |
C10H10O |
Molekylvekt |
146.1858 |
InChI |
InChI=1/C10H10O/c1-7-2-3-8-4-5-10(11)9(8)6-7/h2-3,6H,4-5H2,1H3 |
CAS-nummer |
24623-20-9 |
Molecular Structure |
|
Tetthet |
1.113g/cm3 |
Smeltepunkt |
60-62℃ |
Kokepunkt |
265.1°C at 760 mmHg |
Brytningsindeks |
1.574 |
Flammepunktet |
109.9°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|