ChemNet > CAS > 25016-09-5 1,3-dimethyl-1H-pyrazole-5-carbaldehyde
25016-09-5 1,3-dimethyl-1H-pyrazole-5-carbaldehyde
| produktnavn |
1,3-dimethyl-1H-pyrazole-5-carbaldehyde |
| Synonymer |
1,3-Dimethylpyrazole-5-carbaldehyde; 2,5-dimethylpyrazole-3-carbaldehyde |
| Molekylær Formel |
C6H8N2O |
| Molekylvekt |
124.1405 |
| InChI |
InChI=1/C6H8N2O/c1-5-3-6(4-9)8(2)7-5/h3-4H,1-2H3 |
| CAS-nummer |
25016-09-5 |
| Molecular Structure |
|
| Tetthet |
1.114g/cm3 |
| Smeltepunkt |
40℃ |
| Kokepunkt |
227.739°C at 760 mmHg |
| Brytningsindeks |
1.543 |
| Flammepunktet |
91.534°C |
| Hazard symboler |
 Xi:Irritant;
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
