ChemNet > CAS > 25629-50-9 3-(2-Chlorophenyl)-5-methylisoxazole-4-carbonyl chloride
25629-50-9 3-(2-Chlorophenyl)-5-methylisoxazole-4-carbonyl chloride
| produktnavn |
3-(2-Chlorophenyl)-5-methylisoxazole-4-carbonyl chloride |
| Synonymer |
3-(2-Chlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl chloride; 3-(o-Chlorophenyl)-5-methyl-4-isoxazolecarbonyl chloride; CMIC Chloride |
| Molekylær Formel |
C11H7Cl2NO2 |
| Molekylvekt |
256.0848 |
| InChI |
InChI=1/C11H7Cl2NO2/c1-6-9(11(13)15)10(14-16-6)7-4-2-3-5-8(7)12/h2-5H,1H3 |
| CAS-nummer |
25629-50-9 |
| EINECS |
247-137-4 |
| Molecular Structure |
|
| Tetthet |
1.381g/cm3 |
| Kokepunkt |
381.7°C at 760 mmHg |
| Brytningsindeks |
1.574 |
| Flammepunktet |
184.6°C |
| Hazard symboler |
|
| Risiko Koder |
R34:Causes burns.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
