ChemNet > CAS > 31545-26-3 4-klor-3-nitrofenylcyklopropylketon
31545-26-3 4-klor-3-nitrofenylcyklopropylketon
| produktnavn |
4-klor-3-nitrofenylcyklopropylketon |
| Synonymer |
(4-klor-3-nitrofenyl) (cyklopropyl)metanon |
| Engelsk navn |
4-Chloro-3-nitrophenyl cyclopropyl ketone;(4-chloro-3-nitrophenyl)(cyclopropyl)methanone |
| Molekylær Formel |
C10H8ClNO3 |
| Molekylvekt |
225.6284 |
| InChI |
InChI=1/C10H8ClNO3/c11-8-4-3-7(5-9(8)12(14)15)10(13)6-1-2-6/h3-6H,1-2H2 |
| CAS-nummer |
31545-26-3 |
| EINECS |
250-690-4 |
| Molecular Structure |
|
| Tetthet |
1.464g/cm3 |
| Smeltepunkt |
78-80℃ |
| Kokepunkt |
333.4°C at 760 mmHg |
| Brytningsindeks |
1.631 |
| Flammepunktet |
155.4°C |
| Damptrykk |
0.000137mmHg at 25°C |
| Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|