ChemNet > CAS > 34590-94-8 dipropylene glycol monomethyl ether, mixture of isomers
34590-94-8 dipropylene glycol monomethyl ether, mixture of isomers
produktnavn |
dipropylene glycol monomethyl ether, mixture of isomers |
Synonymer |
Di(propylene glycol) methyl ether; Methoxypropoxypropanol; Dipropylene glycol monomethyl ether; DPM |
Molekylær Formel |
C7H16O3 |
Molekylvekt |
148.2001 |
InChI |
InChI=1/C7H16O3/c1-3-7(8)10-6-4-5-9-2/h7-8H,3-6H2,1-2H3 |
CAS-nummer |
34590-94-8 |
EINECS |
252-104-2 |
Molecular Structure |
|
Tetthet |
0.958g/cm3 |
Kokepunkt |
155.6°C at 760 mmHg |
Brytningsindeks |
1.423 |
Flammepunktet |
47.9°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S23:;
S24/25:;
|
|