3562-73-0 1-(4-Biphenylyl)ethanol
produktnavn |
1-(4-Biphenylyl)ethanol |
Engelsk navn |
1-(4-Biphenylyl)ethanol; 4-Biphenylyl methyl carbinol~4-(1-Hydroxyethyl)biphenyl~alpha-Methyl-4-phenylbenzyl alcohol; 4-(1-Hydroxyethyl)biphenyl; 1-(biphenyl-4-yl)ethanol |
Molekylær Formel |
C14H14O |
Molekylvekt |
198.2604 |
InChI |
InChI=1/C14H14O/c1-11(15)12-7-9-14(10-8-12)13-5-3-2-4-6-13/h2-11,15H,1H3 |
CAS-nummer |
3562-73-0 |
EINECS |
222-629-1 |
Molecular Structure |
|
Tetthet |
1.067g/cm3 |
Smeltepunkt |
95-97℃ |
Kokepunkt |
340.4°C at 760 mmHg |
Brytningsindeks |
1.581 |
Flammepunktet |
148.6°C |
Damptrykk |
3.34E-05mmHg at 25°C |
Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|