ChemNet > CAS > 3592-12-9 5,5-Dimethyl-1,3-dioxan-2-one
3592-12-9 5,5-Dimethyl-1,3-dioxan-2-one
produktnavn |
5,5-Dimethyl-1,3-dioxan-2-one |
Engelsk navn |
5,5-Dimethyl-1,3-dioxan-2-one; Neopentylene carbonate |
Molekylær Formel |
C6H10O3 |
Molekylvekt |
130.1418 |
InChI |
InChI=1/C6H10O3/c1-6(2)3-8-5(7)9-4-6/h3-4H2,1-2H3 |
CAS-nummer |
3592-12-9 |
Molecular Structure |
|
Tetthet |
1.054g/cm3 |
Kokepunkt |
231.5°C at 760 mmHg |
Brytningsindeks |
1.417 |
Flammepunktet |
114.5°C |
Damptrykk |
0.062mmHg at 25°C |
Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|