ChemNet > CAS > 36304-40-2 2-Chlorophenoxyacetic acid hydrazide
36304-40-2 2-Chlorophenoxyacetic acid hydrazide
produktnavn |
2-Chlorophenoxyacetic acid hydrazide |
Synonymer |
ASISCHEM U30989; AKOS BBB/158; 2-Chlorophenoxyacetic acid hydrazide 98%; 2-(2-chlorophenoxy)acetohydrazide |
Molekylær Formel |
C8H9ClN2O2 |
Molekylvekt |
200.6223 |
InChI |
InChI=1/C8H9ClN2O2/c9-6-3-1-2-4-7(6)13-5-8(12)11-10/h1-4H,5,10H2,(H,11,12) |
CAS-nummer |
36304-40-2 |
Molecular Structure |
|
Tetthet |
1.324g/cm3 |
Kokepunkt |
419.8°C at 760 mmHg |
Brytningsindeks |
1.568 |
Flammepunktet |
207.7°C |
Hazard symboler |
Xi:;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|