ChemNet > CAS > 38594-42-2 Dichlorobenzylalcohol; 98%
38594-42-2 Dichlorobenzylalcohol; 98%
produktnavn |
Dichlorobenzylalcohol; 98% |
Synonymer |
2,3-Dichlorobenzyl alcohol; (2,3-dichlorophenyl)methanol |
Molekylær Formel |
C7H6Cl2O |
Molekylvekt |
177.0279 |
InChI |
InChI=1/C7H6Cl2O/c8-6-3-1-2-5(4-10)7(6)9/h1-3,10H,4H2 |
CAS-nummer |
38594-42-2 |
Molecular Structure |
|
Tetthet |
1.392g/cm3 |
Smeltepunkt |
85-88℃ |
Kokepunkt |
271.2°C at 760 mmHg |
Brytningsindeks |
1.582 |
Flammepunktet |
115.8°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|