ChemNet > CAS > 39910-98-0 4-Morpholinoacetophenone
39910-98-0 4-Morpholinoacetophenone
| produktnavn |
4-Morpholinoacetophenone |
| Synonymer |
Acetophenone, 4'-morpholino-; BRN 1214737; p-Morpholinoacetophenone; 1-[4-(morpholin-4-yl)phenyl]ethanone |
| Molekylær Formel |
C12H15NO2 |
| Molekylvekt |
205.253 |
| InChI |
InChI=1/C12H15NO2/c1-10(14)11-2-4-12(5-3-11)13-6-8-15-9-7-13/h2-5H,6-9H2,1H3 |
| CAS-nummer |
39910-98-0 |
| EINECS |
254-698-9 |
| Molecular Structure |
|
| Tetthet |
1.113g/cm3 |
| Smeltepunkt |
94-98℃ |
| Kokepunkt |
376.7°C at 760 mmHg |
| Brytningsindeks |
1.543 |
| Flammepunktet |
181.6°C |
| Hazard symboler |
 Xi:Irritant;
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
