ChemNet > CAS > 4146-43-4 Succinic dihydrazide
4146-43-4 Succinic dihydrazide
| produktnavn |
Succinic dihydrazide |
| Synonymer |
Butanedioyl dihydrazide; Succinic acid dihydrazide; butanedihydrazide |
| Molekylær Formel |
C4H10N4O2 |
| Molekylvekt |
146.1478 |
| InChI |
InChI=1/C4H10N4O2/c5-7-3(9)1-2-4(10)8-6/h1-2,5-6H2,(H,7,9)(H,8,10) |
| CAS-nummer |
4146-43-4 |
| EINECS |
223-970-9 |
| Molecular Structure |
|
| Tetthet |
1.284g/cm3 |
| Smeltepunkt |
170-168℃ |
| Kokepunkt |
540.2°C at 760 mmHg |
| Brytningsindeks |
1.525 |
| Flammepunktet |
280.5°C |
| Hazard symboler |
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
