ChemNet > CAS > 505-54-4 Hexadecanedioic acid
505-54-4 Hexadecanedioic acid
produktnavn |
Hexadecanedioic acid |
Synonymer |
Thapsic acid; 1,16-Hexadecanedioic acid; Hexadecane Diacid; hexadecanedioate |
Molekylær Formel |
C16H28O4 |
Molekylvekt |
284.3922 |
InChI |
InChI=1/C16H30O4/c17-15(18)13-11-9-7-5-3-1-2-4-6-8-10-12-14-16(19)20/h1-14H2,(H,17,18)(H,19,20)/p-2 |
CAS-nummer |
505-54-4 |
EINECS |
208-013-5 |
Molecular Structure |
|
Smeltepunkt |
120-123℃ |
Kokepunkt |
457.5°C at 760 mmHg |
Flammepunktet |
244.6°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|