ChemNet > CAS > 51660-08-3 5-klor-6-fenylpyridazin-3-ol
51660-08-3 5-klor-6-fenylpyridazin-3-ol
| produktnavn |
5-klor-6-fenylpyridazin-3-ol |
| Synonymer |
5-klor-2-metyl-6-fenylpyridazin-3(2H)-en; 5-klor-6-fenylpyridazin-3(2H)-en |
| Engelsk navn |
5-chloro-6-phenylpyridazin-3-ol;5-chloro-2-methyl-6-phenylpyridazin-3(2H)-one; 5-chloro-6-phenylpyridazin-3(2H)-one |
| Molekylær Formel |
C10H7ClN2O |
| Molekylvekt |
206.6284 |
| InChI |
InChI=1/C10H7ClN2O/c11-8-6-9(14)12-13-10(8)7-4-2-1-3-5-7/h1-6H,(H,12,14) |
| CAS-nummer |
51660-08-3 |
| Molecular Structure |
|
| Tetthet |
1.35g/cm3 |
| Smeltepunkt |
235℃ |
| Kokepunkt |
403.2°C at 760 mmHg |
| Brytningsindeks |
1.641 |
| Flammepunktet |
197.7°C |
| Damptrykk |
4.44E-07mmHg at 25°C |
| Hazard symboler |
Xi:Irritant;
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|