ChemNet > CAS > 52178-50-4 methyl 3-formylbenzoate
52178-50-4 methyl 3-formylbenzoate
produktnavn |
methyl 3-formylbenzoate |
Synonymer |
Methyl benzaldehyde-4-carboxylate |
Molekylær Formel |
C9H8O3 |
Molekylvekt |
164.158 |
InChI |
InChI=1/C9H8O3/c1-12-9(11)8-4-2-3-7(5-8)6-10/h2-6H,1H3 |
CAS-nummer |
52178-50-4 |
Molecular Structure |
|
Tetthet |
1.181g/cm3 |
Smeltepunkt |
48-55℃ |
Kokepunkt |
272.8°C at 760 mmHg |
Brytningsindeks |
1.557 |
Flammepunktet |
118.2°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|