ChemNet > CAS > 52708-32-4 4-(3,5-dimethyl-1H-pyrazol-1-yl)aniline
52708-32-4 4-(3,5-dimethyl-1H-pyrazol-1-yl)aniline
produktnavn |
4-(3,5-dimethyl-1H-pyrazol-1-yl)aniline |
Molekylær Formel |
C11H13N3 |
Molekylvekt |
187.241 |
InChI |
InChI=1/C11H13N3/c1-8-7-9(2)14(13-8)11-5-3-10(12)4-6-11/h3-7H,12H2,1-2H3 |
CAS-nummer |
52708-32-4 |
Molecular Structure |
|
Tetthet |
1.14g/cm3 |
Smeltepunkt |
78℃ |
Kokepunkt |
338.2°C at 760 mmHg |
Brytningsindeks |
1.611 |
Flammepunktet |
158.3°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|