ChemNet > CAS > 53218-26-1 6-bromo-1,3-benzothiazole
53218-26-1 6-bromo-1,3-benzothiazole
produktnavn |
6-bromo-1,3-benzothiazole |
Synonymer |
6-Bromobenzothiazole; 6-bromobenzo[d]thiazole |
Molekylær Formel |
C7H4BrNS |
Molekylvekt |
214.0824 |
InChI |
InChI=1/C7H4BrNS/c8-5-1-2-6-7(3-5)10-4-9-6/h1-4H |
CAS-nummer |
53218-26-1 |
Molecular Structure |
|
Tetthet |
1.748g/cm3 |
Smeltepunkt |
52℃ |
Kokepunkt |
291.493°C at 760 mmHg |
Brytningsindeks |
1.718 |
Flammepunktet |
130.09°C |
Hazard symboler |
Xn:Harmful;
|
Risiko Koder |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|