ChemNet > CAS > 541-50-4 Acetoacetic Acid
541-50-4 Acetoacetic Acid
| produktnavn |
Acetoacetic Acid |
| Synonymer |
3-Oxobutanoic acid |
| Molekylær Formel |
C4H6O3 |
| Molekylvekt |
102.0886 |
| InChI |
InChI=1/C4H6O3/c1-3(5)2-4(6)7/h2H2,1H3,(H,6,7) |
| CAS-nummer |
541-50-4 |
| Molecular Structure |
|
| Tetthet |
1.182g/cm3 |
| Kokepunkt |
237.7°C at 760 mmHg |
| Brytningsindeks |
1.427 |
| Flammepunktet |
111.8°C |
| Hazard symboler |
|
| Risiko Koder |
R36/37:Irritating to eyes and respiratory system.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
