ChemNet > CAS > 5866-98-8 2,6-Dichloro-3-nitrobenzonitrile
5866-98-8 2,6-Dichloro-3-nitrobenzonitrile
produktnavn |
2,6-Dichloro-3-nitrobenzonitrile |
Molekylær Formel |
C7H2Cl2N2O2 |
Molekylvekt |
217.009 |
InChI |
InChI=1/C7H2Cl2N2O2/c8-5-1-2-6(11(12)13)7(9)4(5)3-10/h1-2H |
CAS-nummer |
5866-98-8 |
Molecular Structure |
|
Tetthet |
1.61g/cm3 |
Kokepunkt |
341.7°C at 760 mmHg |
Brytningsindeks |
1.615 |
Flammepunktet |
160.5°C |
Hazard symboler |
|
Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|