ChemNet > CAS > 64399-27-5 1-(4-Chlorophenyl)-1-cyclopropanecarbonitrile
64399-27-5 1-(4-Chlorophenyl)-1-cyclopropanecarbonitrile
| produktnavn |
1-(4-Chlorophenyl)-1-cyclopropanecarbonitrile |
| Synonymer |
1-(p-Chlorophenyl)cyclopropanecarbonitrile; 1-(4-chlorophenyl)cyclopropanecarbonitrile |
| Molekylær Formel |
C10H8ClN |
| Molekylvekt |
177.6302 |
| InChI |
InChI=1/C10H8ClN/c11-9-3-1-8(2-4-9)10(7-12)5-6-10/h1-4H,5-6H2 |
| CAS-nummer |
64399-27-5 |
| EINECS |
264-871-0 |
| Molecular Structure |
|
| Tetthet |
1.24g/cm3 |
| Smeltepunkt |
52-56℃ |
| Kokepunkt |
303.1°C at 760 mmHg |
| Brytningsindeks |
1.589 |
| Flammepunktet |
133.1°C |
| Hazard symboler |
 Xi:Irritant;
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|
