ChemNet > CAS > 75705-21-4 4-Aminomethylphenylboronic acid hydrochloride
75705-21-4 4-Aminomethylphenylboronic acid hydrochloride
produktnavn |
4-Aminomethylphenylboronic acid hydrochloride |
Synonymer |
[4-(aminomethyl)phenyl]boronic acid |
Molekylær Formel |
C7H10BNO2 |
Molekylvekt |
150.9708 |
InChI |
InChI=1/C7H10BNO2/c9-5-6-1-3-7(4-2-6)8(10)11/h1-4,10-11H,5,9H2 |
CAS-nummer |
75705-21-4 |
Molecular Structure |
|
Tetthet |
1.18g/cm3 |
Kokepunkt |
337.7°C at 760 mmHg |
Brytningsindeks |
1.567 |
Flammepunktet |
158.1°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|