ChemNet > CAS > 76058-33-8 Ethyl Red
76058-33-8 Ethyl Red
| produktnavn |
Ethyl Red |
| Synonymer |
2-[4-(Diethylamino)phenylazo]benzoic acid; 2-(4-Diethylaminophenylazo)benzoic acid; Diethyl red; 2-{(E)-[4-(diethylamino)phenyl]diazenyl}benzoate |
| Molekylær Formel |
C17H18N3O2 |
| Molekylvekt |
296.3443 |
| InChI |
InChI=1/C17H19N3O2/c1-3-20(4-2)14-11-9-13(10-12-14)18-19-16-8-6-5-7-15(16)17(21)22/h5-12H,3-4H2,1-2H3,(H,21,22)/p-1/b19-18+ |
| CAS-nummer |
76058-33-8 |
| Molecular Structure |
|
| Smeltepunkt |
135℃ |
| Kokepunkt |
496.9°C at 760 mmHg |
| Flammepunktet |
254.3°C |
| Hazard symboler |
 Xn:Harmful;
|
| Risiko Koder |
R20/21:Harmful by inhalation and in contact with skin.;
R32:Contact with acids liberates very toxic gas.;
|
| Sikkerhet Beskrivelse |
|
|
