ChemNet > CAS > 825-44-5 Thianaphthene-1,1-dioxide
825-44-5 Thianaphthene-1,1-dioxide
| produktnavn |
Thianaphthene-1,1-dioxide |
| Synonymer |
Thianaphthene 1,1-dioxide; Benzo[b]thiophene 1,1-dioxide; 1-benzothiophene 1,1-dioxide |
| Molekylær Formel |
C8H6O2S |
| Molekylvekt |
166.197 |
| InChI |
InChI=1/C8H6O2S/c9-11(10)6-5-7-3-1-2-4-8(7)11/h1-6H |
| CAS-nummer |
825-44-5 |
| EINECS |
212-544-8 |
| Molecular Structure |
|
| Tetthet |
1.403g/cm3 |
| Smeltepunkt |
137-138℃ |
| Kokepunkt |
371.1°C at 760 mmHg |
| Brytningsindeks |
1.64 |
| Flammepunktet |
244°C |
| Hazard symboler |
|
| Risiko Koder |
|
| Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|
